6-methoxy-1-trimethylsilyloxy-3,4-dihydro-2H-naphthalene-1-carbonitrile structure
|
Common Name | 6-methoxy-1-trimethylsilyloxy-3,4-dihydro-2H-naphthalene-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 80859-07-0 | Molecular Weight | 275.41800 | |
| Density | 1.05g/cm3 | Boiling Point | 368ºC at 760 mmHg | |
| Molecular Formula | C15H21NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.4ºC | |
| Name | 6-methoxy-1-trimethylsilyloxy-3,4-dihydro-2H-naphthalene-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 368ºC at 760 mmHg |
| Molecular Formula | C15H21NO2Si |
| Molecular Weight | 275.41800 |
| Flash Point | 176.4ºC |
| Exact Mass | 275.13400 |
| PSA | 42.25000 |
| LogP | 3.60188 |
| Index of Refraction | 1.515 |
| InChIKey | RRKRHTAHELQMFY-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CCCC2(C#N)O[Si](C)(C)C |
|
~99%
6-methoxy-1-tri... CAS#:80859-07-0 |
| Literature: Beeley, Nigel R. A.; Cremer, Gerard; Dorlhene, Alain; Mompon, Bernard; Pascard, Claudine; Tran Huu Dau, Elise Journal of the Chemical Society, Chemical Communications, 1983 , # 18 p. 1046 - 1048 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 6-methoxy-1-(trimethylsilanyloxy)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
| 1-cyano-6-methoxy-1-trimethylsiloxy-1,2,3,4-tetrahydronaphthalene |
| 1-cyano-1-trimethylsiloxy-6-methoxy-1,2,3,4-tetrahydronaphthalene |
| 1-cyano-1-trimethylsilyloxy-6-methoxy-1,2,3,4-tetrahydronaphthalene |
| 6-methoxy-1-trimethylsilyloxy-tetralin-1-carbonitrile |