4-Methylbenzyl 4-oxopiperidine-1-carboxylate
Modify Date: 2026-07-22 01:12:03
4-Methylbenzyl 4-oxopiperidine-1-carboxylate structure
|
Common Name | 4-Methylbenzyl 4-oxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 808733-12-2 | Molecular Weight | 247.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Methylbenzyl 4-oxopiperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17NO3 |
|---|---|
| Molecular Weight | 247.29 |
| InChIKey | OEGDILXHJWLBNR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(COC(=O)N2CCC(=O)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate? |
| A: The English name of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate is 4-Methylbenzyl 4-oxopiperidine-1-carboxylate. |
| Q: What is the SMILES notation of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate? |
| A: SMILES notation of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate is Cc1ccc(COC(=O)N2CCC(=O)CC2)cc1. |
| Q: What is the molecular formula of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate? |
| A: Molecular formula of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate is C14H17NO3. |
| Q: What is the CAS number of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate? |
| A: CAS number of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate is 808733-12-2. |
| Q: What is the molecular weight of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate? |
| A: Molecular weight of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate is 247.29. |
| Q: What is the Chinese name of 808733-12-2? |
| A: Chinese name of 808733-12-2 is 808733-12-2. |
| Q: What is the InChIKey of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate? |
| A: InChIKey of 4-Methylbenzyl 4-oxopiperidine-1-carboxylate is OEGDILXHJWLBNR-UHFFFAOYSA-N. |