Strychnidin-10-one, compd. with methylarsonate (1:1) structure
|
Common Name | Strychnidin-10-one, compd. with methylarsonate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 80879-64-7 | Molecular Weight | 474.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H27AsN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | strychnine, compound with methylarsonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H27AsN2O5 |
|---|---|
| Molecular Weight | 474.38200 |
| Exact Mass | 474.11400 |
| PSA | 90.31000 |
| LogP | 1.06560 |
| InChIKey | BMGIVNDVKUXRPC-ZEYGOCRCSA-N |
| SMILES | C[As](=O)(O)O.O=C1CC2OCC=C3CN4CCC56c7ccccc7N1C5C2C3CC46 |
| Strychnin, Verbindung mit Methylarsonsaeure |
| strychnidin-10-one, compound with methylarsonate (1:1) |