2-Mercapto-4-nitrophenol
Modify Date: 2025-09-28 16:19:58
2-Mercapto-4-nitrophenol structure
|
Common Name | 2-Mercapto-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 80882-33-3 | Molecular Weight | 171.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Mercapto-4-nitrophenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5NO3S |
|---|---|
| Molecular Weight | 171.18 |
| InChIKey | DWPJITHBBYXNHW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(S)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-Mercapto-4-nitrophenol? |
| A: Molecular weight of 2-Mercapto-4-nitrophenol is 171.18. |
| Q: What is the CAS number of 2-Mercapto-4-nitrophenol? |
| A: CAS number of 2-Mercapto-4-nitrophenol is 80882-33-3. |
| Q: What is the InChIKey of 2-Mercapto-4-nitrophenol? |
| A: InChIKey of 2-Mercapto-4-nitrophenol is DWPJITHBBYXNHW-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Mercapto-4-nitrophenol? |
| A: The English name of 2-Mercapto-4-nitrophenol is 2-Mercapto-4-nitrophenol. |
| Q: What is the Chinese name of 80882-33-3? |
| A: Chinese name of 80882-33-3 is 80882-33-3. |
| Q: What is the molecular formula of 2-Mercapto-4-nitrophenol? |
| A: Molecular formula of 2-Mercapto-4-nitrophenol is C6H5NO3S. |
| Q: What is the SMILES notation of 2-Mercapto-4-nitrophenol? |
| A: SMILES notation of 2-Mercapto-4-nitrophenol is O=[N+]([O-])c1ccc(O)c(S)c1. |