N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine
![N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine Structure](https://image.chemsrc.com/caspic/288/80920-62-3.png)
N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine structure
|
Common Name | N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 80920-62-3 | Molecular Weight | 430.69400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H55N4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H55N4P |
|---|---|
| Molecular Weight | 430.69400 |
| Exact Mass | 430.41600 |
| PSA | 31.89000 |
| LogP | 7.87890 |
| InChIKey | JIVOJUCJHSERBQ-UHFFFAOYSA-N |
| SMILES | CCCCN=P(N(CC)CC)(N(CCCC)CCCC)N(CCCC)CCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-butyl-N-[buty... CAS#:80920-62-3 |
| Literature: Kovenya, V. A.; Marchenko, A. P.; Pinchuk, A. M. J. Gen. Chem. USSR (Engl. Transl.), 1981 , vol. 51, # 12 p. 2678 - 2684,2310 - 2314 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphorimidic triamide,N,N,N',N',N'''-pentabutyl-N'',N''-diethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: Polar surface area (PSA) of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine is 31.89000. |
| Q: What is the molecular formula of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: Molecular formula of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine is C24H55N4P. |
| Q: What is the InChIKey of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: InChIKey of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine is JIVOJUCJHSERBQ-UHFFFAOYSA-N. |
| Q: What is the English name of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: The English name of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine is N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine. |
| Q: What are the upstream materials of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: Related upstream materials(CAS) of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine: 66911-82-8. |
| Q: What English synonyms does N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine have? |
| A: English synonyms of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine: Phosphorimidic triamide,N,N,N',N',N'''-pentabutyl-N'',N''-diethyl. |
| Q: What is the LogP of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: LogP of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine is 7.87890. |
| Q: What is the molecular weight of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: Molecular weight of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine is 430.69400. |
| Q: What is the Chinese name of 80920-62-3? |
| A: Chinese name of 80920-62-3 is 80920-62-3. |
| Q: What is the SMILES notation of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine? |
| A: SMILES notation of N-butyl-N-[butylimino-(dibutylamino)-(diethylamino)-λ5-phosphanyl]butan-1-amine is CCCCN=P(N(CC)CC)(N(CCCC)CCCC)N(CCCC)CCCC. |