(2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane
(2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane structure
|
Common Name | (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 809233-47-4 | Molecular Weight | 352.67300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32S2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H32S2Si |
|---|---|
| Molecular Weight | 352.67300 |
| Exact Mass | 352.17100 |
| PSA | 50.60000 |
| LogP | 7.23900 |
| InChIKey | STZXCILXCJQDTH-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)C1(c2ccccc2)SCCCS1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
(2-phenyl-1,3-d... CAS#:809233-47-4 |
| Literature: Clayden, Jonathan; Watson, David W.; Chambers, Mark Tetrahedron, 2005 , vol. 61, # 13 p. 3195 - 3203 |
|
~67%
(2-phenyl-1,3-d... CAS#:809233-47-4 |
| Literature: Svarovsky, Serge A.; Taraban, Marc B.; Barchi Jr., Joseph J. Organic and Biomolecular Chemistry, 2004 , vol. 2, # 21 p. 3155 - 3161 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| triisopropyl-(2-phenyl-[1,3]dithian-2-yl)-silane |
| 2-phenyl-2-triisopropylsilyl-1,3-dithiane |
| Silane,tris(1-methylethyl)(2-phenyl-1,3-dithian-2-yl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: Molecular formula of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is C19H32S2Si. |
| Q: What is the SMILES notation of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: SMILES notation of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is CC(C)[Si](C(C)C)(C(C)C)C1(c2ccccc2)SCCCS1. |
| Q: What is the InChIKey of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: InChIKey of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is STZXCILXCJQDTH-UHFFFAOYSA-N. |
| Q: What is the English name of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: The English name of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane. |
| Q: What is the Chinese name of 809233-47-4? |
| A: Chinese name of 809233-47-4 is 809233-47-4. |
| Q: What is the CAS number of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: CAS number of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is 809233-47-4. |
| Q: What is the LogP of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: LogP of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is 7.23900. |
| Q: What is the polar surface area (PSA) of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: Polar surface area (PSA) of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is 50.60000. |
| Q: What are the upstream materials of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: Related upstream materials(CAS) of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane: 5425-44-5;13154-24-0;80522-42-5. |
| Q: What is the molecular weight of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane? |
| A: Molecular weight of (2-phenyl-1,3-dithian-2-yl)-tri(propan-2-yl)silane is 352.67300. |