Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate
Modify Date: 2025-09-11 18:55:42
![Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate Structure](https://www.chemsrc.com/extcaspic/260/809237-69-2.png)
Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate structure
|
Common Name | Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 809237-69-2 | Molecular Weight | 307.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21N3O4 |
|---|---|
| Molecular Weight | 307.34 |
| InChIKey | NGYHWOVGFKOAOS-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1ccc(NCC2CCCCC2)c([N+](=O)[O-])c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 809237-69-2? |
| A: Chinese name of 809237-69-2 is 809237-69-2. |
| Q: What is the CAS number of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate? |
| A: CAS number of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate is 809237-69-2. |
| Q: What is the English name of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate? |
| A: The English name of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate is Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate. |
| Q: What is the SMILES notation of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate? |
| A: SMILES notation of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate is COC(=O)Nc1ccc(NCC2CCCCC2)c([N+](=O)[O-])c1. |
| Q: What is the InChIKey of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate? |
| A: InChIKey of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate is NGYHWOVGFKOAOS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate? |
| A: Molecular formula of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate is C15H21N3O4. |
| Q: What is the molecular weight of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate? |
| A: Molecular weight of Methyl {4-[(cyclohexylmethyl)amino]-3-nitrophenyl}carbamate is 307.34. |