GnetumontaninA
Modify Date: 2026-07-06 08:16:39
GnetumontaninA structure
|
Common Name | GnetumontaninA | ||
|---|---|---|---|---|
| CAS Number | 809237-86-3 | Molecular Weight | 486.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | GnetumontaninA |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H22O8 |
|---|---|
| Molecular Weight | 486.5 |
| InChIKey | KHGLRDMKSFZQRZ-PXXWLXOCSA-N |
| SMILES | Oc1cc(O)cc(C2c3c(O)cc(C=Cc4ccc(O)cc4O)cc3OC2c2ccc(O)cc2O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of GnetumontaninA? |
| A: Molecular weight of GnetumontaninA is 486.5. |
| Q: What is the InChIKey of GnetumontaninA? |
| A: InChIKey of GnetumontaninA is KHGLRDMKSFZQRZ-PXXWLXOCSA-N. |
| Q: What is the molecular formula of GnetumontaninA? |
| A: Molecular formula of GnetumontaninA is C28H22O8. |
| Q: What is the English name of GnetumontaninA? |
| A: The English name of GnetumontaninA is GnetumontaninA. |
| Q: What is the CAS number of GnetumontaninA? |
| A: CAS number of GnetumontaninA is 809237-86-3. |
| Q: What is the SMILES notation of GnetumontaninA? |
| A: SMILES notation of GnetumontaninA is Oc1cc(O)cc(C2c3c(O)cc(C=Cc4ccc(O)cc4O)cc3OC2c2ccc(O)cc2O)c1. |
| Q: What is the Chinese name of 809237-86-3? |
| A: Chinese name of 809237-86-3 is 809237-86-3. |