GnetumontaninC
Modify Date: 2026-07-20 22:52:36
GnetumontaninC structure
|
Common Name | GnetumontaninC | ||
|---|---|---|---|---|
| CAS Number | 809237-88-5 | Molecular Weight | 434.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | GnetumontaninC |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H22O7 |
|---|---|
| Molecular Weight | 434.4 |
| InChIKey | HUNGNQPYCWAZFI-HWKANZROSA-N |
| SMILES | COc1cc(C=Cc2cc(O)cc3c2C(c2ccc(O)c(OC)c2)CC(=O)O3)ccc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of GnetumontaninC? |
| A: SMILES notation of GnetumontaninC is COc1cc(C=Cc2cc(O)cc3c2C(c2ccc(O)c(OC)c2)CC(=O)O3)ccc1O. |
| Q: What is the InChIKey of GnetumontaninC? |
| A: InChIKey of GnetumontaninC is HUNGNQPYCWAZFI-HWKANZROSA-N. |
| Q: What is the molecular formula of GnetumontaninC? |
| A: Molecular formula of GnetumontaninC is C25H22O7. |
| Q: What is the molecular weight of GnetumontaninC? |
| A: Molecular weight of GnetumontaninC is 434.4. |
| Q: What is the English name of GnetumontaninC? |
| A: The English name of GnetumontaninC is GnetumontaninC. |
| Q: What is the Chinese name of 809237-88-5? |
| A: Chinese name of 809237-88-5 is 809237-88-5. |
| Q: What is the CAS number of GnetumontaninC? |
| A: CAS number of GnetumontaninC is 809237-88-5. |