O-|A-D-glucopyranoside
Modify Date: 2025-08-26 18:30:45
O-|A-D-glucopyranoside structure
|
Common Name | O-|A-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 809237-89-6 | Molecular Weight | 596.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H32O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-|A-D-glucopyranoside |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H32O12 |
|---|---|
| Molecular Weight | 596.6 |
| InChIKey | DLISHVXRKZKMPC-VGQDMXHKSA-N |
| SMILES | COc1cc(C2CC(=O)Oc3cc(O)cc(C=Cc4ccc(OC5OC(CO)C(O)C(O)C5O)c(OC)c4)c32)ccc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of O-|A-D-glucopyranoside? |
| A: CAS number of O-|A-D-glucopyranoside is 809237-89-6. |
| Q: What is the Chinese name of 809237-89-6? |
| A: Chinese name of 809237-89-6 is 809237-89-6. |
| Q: What is the InChIKey of O-|A-D-glucopyranoside? |
| A: InChIKey of O-|A-D-glucopyranoside is DLISHVXRKZKMPC-VGQDMXHKSA-N. |
| Q: What is the SMILES notation of O-|A-D-glucopyranoside? |
| A: SMILES notation of O-|A-D-glucopyranoside is COc1cc(C2CC(=O)Oc3cc(O)cc(C=Cc4ccc(OC5OC(CO)C(O)C(O)C5O)c(OC)c4)c32)ccc1O. |
| Q: What is the molecular weight of O-|A-D-glucopyranoside? |
| A: Molecular weight of O-|A-D-glucopyranoside is 596.6. |
| Q: What is the English name of O-|A-D-glucopyranoside? |
| A: The English name of O-|A-D-glucopyranoside is O-|A-D-glucopyranoside. |
| Q: What is the molecular formula of O-|A-D-glucopyranoside? |
| A: Molecular formula of O-|A-D-glucopyranoside is C31H32O12. |