1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl)
Modify Date: 2025-08-25 19:36:37
1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) structure
|
Common Name | 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 809274-75-7 | Molecular Weight | 378.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11IN2O2 |
|---|---|
| Molecular Weight | 378.16 |
| InChIKey | HWPKJGUOXCZHCC-UHFFFAOYSA-N |
| SMILES | Cc1c(I)n(-c2ccc([N+](=O)[O-])cc2)c2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl)? |
| A: Molecular formula of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) is C15H11IN2O2. |
| Q: What is the CAS number of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl)? |
| A: CAS number of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) is 809274-75-7. |
| Q: What is the molecular weight of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl)? |
| A: Molecular weight of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) is 378.16. |
| Q: What is the SMILES notation of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl)? |
| A: SMILES notation of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) is Cc1c(I)n(-c2ccc([N+](=O)[O-])cc2)c2ccccc12. |
| Q: What is the InChIKey of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl)? |
| A: InChIKey of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) is HWPKJGUOXCZHCC-UHFFFAOYSA-N. |
| Q: What is the English name of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl)? |
| A: The English name of 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl) is 1h-Indole,2-iodo-3-methyl-1-(4-nitrophenyl). |
| Q: What is the Chinese name of 809274-75-7? |
| A: Chinese name of 809274-75-7 is 809274-75-7. |