(benzene-1,3,5-triyl)triacetonitrile
(benzene-1,3,5-triyl)triacetonitrile structure
|
Common Name | (benzene-1,3,5-triyl)triacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 80935-59-7 | Molecular Weight | 195.22000 | |
| Density | 1.161±0.06g/ml(Predicted) | Boiling Point | 429.0±40.0℃(Predicted) | |
| Molecular Formula | C12H9N3 | Melting Point | 123-125℃ | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (benzene-1,3,5-triyl)triacetonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.161±0.06g/ml(Predicted) |
|---|---|
| Boiling Point | 429.0±40.0℃(Predicted) |
| Melting Point | 123-125℃ |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22000 |
| Exact Mass | 195.08000 |
| PSA | 71.37000 |
| LogP | 1.88484 |
| InChIKey | QEIMSNKURDQYSE-UHFFFAOYSA-N |
| SMILES | N#CCc1cc(CC#N)cc(CC#N)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![2-[3,5-bis(carboxymethyl)phenyl]acetic acid structure](https://image.chemsrc.com/caspic/075/4435-67-0.png)
CAS#:4435-67-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,5-benzenetriacetonitrile |
| 1,3,5-(tricyanomethyl)benzene |
| 1,3,5-tri(cyanomethyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (benzene-1,3,5-triyl)triacetonitrile? |
| A: Molecular weight of (benzene-1,3,5-triyl)triacetonitrile is 195.22000. |
| Q: What is the CAS number of (benzene-1,3,5-triyl)triacetonitrile? |
| A: CAS number of (benzene-1,3,5-triyl)triacetonitrile is 80935-59-7. |
| Q: What is the English name of (benzene-1,3,5-triyl)triacetonitrile? |
| A: The English name of (benzene-1,3,5-triyl)triacetonitrile is (benzene-1,3,5-triyl)triacetonitrile. |
| Q: What is the polar surface area (PSA) of (benzene-1,3,5-triyl)triacetonitrile? |
| A: Polar surface area (PSA) of (benzene-1,3,5-triyl)triacetonitrile is 71.37000. |
| Q: What is the SMILES notation of (benzene-1,3,5-triyl)triacetonitrile? |
| A: SMILES notation of (benzene-1,3,5-triyl)triacetonitrile is N#CCc1cc(CC#N)cc(CC#N)c1. |
| Q: What is the InChIKey of (benzene-1,3,5-triyl)triacetonitrile? |
| A: InChIKey of (benzene-1,3,5-triyl)triacetonitrile is QEIMSNKURDQYSE-UHFFFAOYSA-N. |
| Q: What is the melting point of (benzene-1,3,5-triyl)triacetonitrile? |
| A: Melting point of (benzene-1,3,5-triyl)triacetonitrile is 123-125℃. |
| Q: What is the molecular formula of (benzene-1,3,5-triyl)triacetonitrile? |
| A: Molecular formula of (benzene-1,3,5-triyl)triacetonitrile is C12H9N3. |
| Q: What is the boiling point of (benzene-1,3,5-triyl)triacetonitrile? |
| A: Boiling point of (benzene-1,3,5-triyl)triacetonitrile is 429.0±40.0℃(Predicted). |
| Q: What is the LogP of (benzene-1,3,5-triyl)triacetonitrile? |
| A: LogP of (benzene-1,3,5-triyl)triacetonitrile is 1.88484. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |