butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate
butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate structure
|
Common Name | butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 80944-98-5 | Molecular Weight | 310.00200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12Cl4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12Cl4O3 |
|---|---|
| Molecular Weight | 310.00200 |
| Exact Mass | 307.95400 |
| PSA | 35.53000 |
| LogP | 3.07470 |
| InChIKey | VPFHSBSICUITTM-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1(Cl)OC(Cl)C(Cl)C1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
butyl 2,3,4,5-t... CAS#:80944-98-5 |
| Literature: Virginia Carolina Chem. Corp. Patent: US2811478 , 1954 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,4,5-tetrachloro-tetrahydro-furan-2-carboxylic acid butyl ester |
| 2-Furancarboxylic acid,2,3,4,5-tetrachlorotetrahydro-,butyl ester |
| 2,3,4,5-Tetrachlor-tetrahydro-furan-2-carbonsaeure-butylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: LogP of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate is 3.07470. |
| Q: What is the InChIKey of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: InChIKey of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate is VPFHSBSICUITTM-UHFFFAOYSA-N. |
| Q: What is the English name of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: The English name of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate is butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate. |
| Q: What is the CAS number of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: CAS number of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate is 80944-98-5. |
| Q: What English synonyms does butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate have? |
| A: English synonyms of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate: 2,3,4,5-tetrachloro-tetrahydro-furan-2-carboxylic acid butyl ester, 2-Furancarboxylic acid,2,3,4,5-tetrachlorotetrahydro-,butyl ester, 2,3,4,5-Tetrachlor-tetrahydro-furan-2-carbonsaeure-butylester. |
| Q: What is the Chinese name of 80944-98-5? |
| A: Chinese name of 80944-98-5 is 80944-98-5. |
| Q: What is the molecular weight of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: Molecular weight of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate is 310.00200. |
| Q: What is the polar surface area (PSA) of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: Polar surface area (PSA) of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate is 35.53000. |
| Q: What are the upstream materials of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: Related upstream materials(CAS) of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate: 583-33-5. |
| Q: What is the SMILES notation of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate? |
| A: SMILES notation of butyl 2,3,4,5-tetrachlorooxolane-2-carboxylate is CCCCOC(=O)C1(Cl)OC(Cl)C(Cl)C1Cl. |