3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one
![3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one Structure](https://image.chemsrc.com/caspic/246/80945-22-8.png)
3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one structure
|
Common Name | 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 80945-22-8 | Molecular Weight | 206.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18O2 |
|---|---|
| Molecular Weight | 206.28100 |
| Exact Mass | 206.13100 |
| PSA | 29.60000 |
| LogP | 2.64540 |
| InChIKey | PRIYMDVITBTJRJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)CC(C)(C)C1=CC1OC1C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,5,5-trimethyl... CAS#:80945-22-8 |
| Literature: Takazawa, Osamu; Kogami, Kunio; Hayashi, Kazuo Chemistry Letters, 1983 , p. 63 - 64 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Cyclohexen-1-one,3,5,5-trimethyl-4-[(3-methyloxiranyl)methylene] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: Molecular formula of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one is C13H18O2. |
| Q: What is the molecular weight of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: Molecular weight of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one is 206.28100. |
| Q: What is the CAS number of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: CAS number of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one is 80945-22-8. |
| Q: What is the LogP of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: LogP of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one is 2.64540. |
| Q: What is the InChIKey of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: InChIKey of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one is PRIYMDVITBTJRJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 80945-22-8? |
| A: Chinese name of 80945-22-8 is 80945-22-8. |
| Q: What English synonyms does 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one have? |
| A: English synonyms of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one: 2-Cyclohexen-1-one,3,5,5-trimethyl-4-[(3-methyloxiranyl)methylene]. |
| Q: What are the upstream materials of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: Related upstream materials(CAS) of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one: 13215-88-8. |
| Q: What is the English name of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: The English name of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one is 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one. |
| Q: What is the SMILES notation of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one? |
| A: SMILES notation of 3,5,5-trimethyl-4-[(3-methyloxiran-2-yl)methylidene]cyclohex-2-en-1-one is CC1=CC(=O)CC(C)(C)C1=CC1OC1C. |