6-(benzenesulfonyl)undeca-1,8-dien-5-one
6-(benzenesulfonyl)undeca-1,8-dien-5-one structure
|
Common Name | 6-(benzenesulfonyl)undeca-1,8-dien-5-one | ||
|---|---|---|---|---|
| CAS Number | 80945-35-3 | Molecular Weight | 306.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(benzenesulfonyl)undeca-1,8-dien-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H22O3S |
|---|---|
| Molecular Weight | 306.42000 |
| Exact Mass | 306.12900 |
| PSA | 59.59000 |
| LogP | 4.80130 |
| InChIKey | TWSFPUPYFLAFLL-UHFFFAOYSA-N |
| SMILES | C=CCCC(=O)C(CC=CCC)S(=O)(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
6-(benzenesulfo... CAS#:80945-35-3 |
| Literature: Ochiai, Masahito; Sumi, Kenzo; Fujita, Eiichi Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 11 p. 3931 - 3938 |
|
~%
6-(benzenesulfo... CAS#:80945-35-3 |
| Literature: Ochiai, Masahito; Sumi, Kenzo; Fujita, Eiichi Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 11 p. 3931 - 3938 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:74420-27-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,8-Undecadien-5-one,6-(phenylsulfonyl)-,(Z) |
| cis-6-phenylsulfonylundeca-1,8-dien-5-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 6-(benzenesulfonyl)undeca-1,8-dien-5-one have? |
| A: English synonyms of 6-(benzenesulfonyl)undeca-1,8-dien-5-one: 1,8-Undecadien-5-one,6-(phenylsulfonyl)-,(Z), cis-6-phenylsulfonylundeca-1,8-dien-5-one. |
| Q: What is the InChIKey of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: InChIKey of 6-(benzenesulfonyl)undeca-1,8-dien-5-one is TWSFPUPYFLAFLL-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: Polar surface area (PSA) of 6-(benzenesulfonyl)undeca-1,8-dien-5-one is 59.59000. |
| Q: What is the molecular weight of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: Molecular weight of 6-(benzenesulfonyl)undeca-1,8-dien-5-one is 306.42000. |
| Q: What is the Chinese name of 80945-35-3? |
| A: Chinese name of 80945-35-3 is 80945-35-3. |
| Q: What are the upstream materials of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: Related upstream materials(CAS) of 6-(benzenesulfonyl)undeca-1,8-dien-5-one: 80945-34-2;74420-26-1. |
| Q: What is the SMILES notation of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: SMILES notation of 6-(benzenesulfonyl)undeca-1,8-dien-5-one is C=CCCC(=O)C(CC=CCC)S(=O)(=O)c1ccccc1. |
| Q: What are the downstream products of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: Related downstream products(CAS) of 6-(benzenesulfonyl)undeca-1,8-dien-5-one: 74420-27-2. |
| Q: What is the molecular formula of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: Molecular formula of 6-(benzenesulfonyl)undeca-1,8-dien-5-one is C17H22O3S. |
| Q: What is the LogP of 6-(benzenesulfonyl)undeca-1,8-dien-5-one? |
| A: LogP of 6-(benzenesulfonyl)undeca-1,8-dien-5-one is 4.80130. |