6-(benzenesulfonyl)undeca-1,8-dien-5-one
Modify Date: 2025-08-20 09:45:51
6-(benzenesulfonyl)undeca-1,8-dien-5-one structure
|
Common Name | 6-(benzenesulfonyl)undeca-1,8-dien-5-one | ||
|---|---|---|---|---|
| CAS Number | 80945-35-3 | Molecular Weight | 306.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(benzenesulfonyl)undeca-1,8-dien-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H22O3S |
|---|---|
| Molecular Weight | 306.42000 |
| Exact Mass | 306.12900 |
| PSA | 59.59000 |
| LogP | 4.80130 |
| InChIKey | TWSFPUPYFLAFLL-UHFFFAOYSA-N |
| SMILES | C=CCCC(=O)C(CC=CCC)S(=O)(=O)c1ccccc1 |
|
~97%
6-(benzenesulfo... CAS#:80945-35-3 |
| Literature: Ochiai, Masahito; Sumi, Kenzo; Fujita, Eiichi Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 11 p. 3931 - 3938 |
|
~%
6-(benzenesulfo... CAS#:80945-35-3 |
| Literature: Ochiai, Masahito; Sumi, Kenzo; Fujita, Eiichi Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 11 p. 3931 - 3938 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:74420-27-2| 1,8-Undecadien-5-one,6-(phenylsulfonyl)-,(Z) |
| cis-6-phenylsulfonylundeca-1,8-dien-5-one |