methyl 2-oxo-2-(p-tolylamino)acetate
methyl 2-oxo-2-(p-tolylamino)acetate structure
|
Common Name | methyl 2-oxo-2-(p-tolylamino)acetate | ||
|---|---|---|---|---|
| CAS Number | 80945-63-7 | Molecular Weight | 193.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-oxo-2-(p-tolylamino)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11NO3 |
|---|---|
| Molecular Weight | 193.19900 |
| Exact Mass | 193.07400 |
| PSA | 55.40000 |
| LogP | 1.17950 |
| InChIKey | WKCBGTDLRXXYDR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)Nc1ccc(C)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:42868-89-3
CAS#:622-58-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Tolyl-oxamidsaeure-methylester |
| Oxalsaeure-methylester-p-toluidid |
| N-p-Tolyl-oxalamidsaeure-methylester |
| methyl N-(4-methylphenyl)oxamate |
| Methyl-N-(p-tolyl)-oxamidat |
| N-p-tolyl-oxalamic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: CAS number of methyl 2-oxo-2-(p-tolylamino)acetate is 80945-63-7. |
| Q: What is the InChIKey of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: InChIKey of methyl 2-oxo-2-(p-tolylamino)acetate is WKCBGTDLRXXYDR-UHFFFAOYSA-N. |
| Q: What are the downstream products of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: Related downstream products(CAS) of methyl 2-oxo-2-(p-tolylamino)acetate: 42868-89-3;622-58-2. |
| Q: What is the polar surface area (PSA) of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: Polar surface area (PSA) of methyl 2-oxo-2-(p-tolylamino)acetate is 55.40000. |
| Q: What is the LogP of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: LogP of methyl 2-oxo-2-(p-tolylamino)acetate is 1.17950. |
| Q: What is the SMILES notation of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: SMILES notation of methyl 2-oxo-2-(p-tolylamino)acetate is COC(=O)C(=O)Nc1ccc(C)cc1. |
| Q: What is the Chinese name of 80945-63-7? |
| A: Chinese name of 80945-63-7 is 80945-63-7. |
| Q: What English synonyms does methyl 2-oxo-2-(p-tolylamino)acetate have? |
| A: English synonyms of methyl 2-oxo-2-(p-tolylamino)acetate: p-Tolyl-oxamidsaeure-methylester, Oxalsaeure-methylester-p-toluidid, N-p-Tolyl-oxalamidsaeure-methylester, methyl N-(4-methylphenyl)oxamate, Methyl-N-(p-tolyl)-oxamidat, N-p-tolyl-oxalamic acid methyl ester. |
| Q: What is the English name of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: The English name of methyl 2-oxo-2-(p-tolylamino)acetate is methyl 2-oxo-2-(p-tolylamino)acetate. |
| Q: What is the molecular weight of methyl 2-oxo-2-(p-tolylamino)acetate? |
| A: Molecular weight of methyl 2-oxo-2-(p-tolylamino)acetate is 193.19900. |