5(4H)-Oxazolone,4-[(1,2-dihydro-1-phenyl-2-thioxo-3-pyridinyl)methylene]-2-phenyl- structure
|
Common Name | 5(4H)-Oxazolone,4-[(1,2-dihydro-1-phenyl-2-thioxo-3-pyridinyl)methylene]-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 80947-47-3 | Molecular Weight | 358.41300 | |
| Density | 1.25g/cm3 | Boiling Point | 491.6ºC at 760mmHg | |
| Molecular Formula | C21H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
| Name | (4E)-2-phenyl-4-[(1-phenyl-2-sulfanylidenepyridin-3-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 491.6ºC at 760mmHg |
| Molecular Formula | C21H14N2O2S |
| Molecular Weight | 358.41300 |
| Flash Point | 251.1ºC |
| Exact Mass | 358.07800 |
| PSA | 75.68000 |
| LogP | 3.98690 |
| Index of Refraction | 1.665 |
| InChIKey | GVASNDIHKCIYBY-NBVRZTHBSA-N |
| SMILES | O=C1OC(c2ccccc2)=NC1=Cc1cccn(-c2ccccc2)c1=S |
|
~59%
5(4H)-Oxazolone... CAS#:80947-47-3 |
| Literature: Christensen, Mads Chr.; Becher, Jan Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1357 - 1363 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| azlactone of 1-phenyl-2-(1H)pyridinethione-3-carbaldehyde |