1H-Pyridazino(4,5-b)indole-1,4(5H)-dione, 2,3-dihydro
1H-Pyridazino(4,5-b)indole-1,4(5H)-dione, 2,3-dihydro structure
|
Common Name | 1H-Pyridazino(4,5-b)indole-1,4(5H)-dione, 2,3-dihydro | ||
|---|---|---|---|---|
| CAS Number | 80985-55-3 | Molecular Weight | 201.18100 | |
| Density | 1.504g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione, also known as 1H-pyridazino(4,5-b)indole-1,4(5H)-dione, 2,3-dihydro, CAS number 80985-55-3, molecular formula C10H7N3O2, molecular weight 201.18100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.504g/cm3 |
|---|---|
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.18100 |
| Exact Mass | 201.05400 |
| PSA | 82.03000 |
| LogP | 1.52230 |
| Index of Refraction | 1.723 |
| InChIKey | PPGNWVBGMDBNHD-UHFFFAOYSA-N |
| SMILES | O=c1[nH][nH]c(=O)c2c1[nH]c1ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
1H-Pyridazino(4... CAS#:80985-55-3 |
| Literature: Kurumi, Masateru; Sasaki, Kenji; Takata, Hiroko; Nakayama, Taiji Heterocycles, 2000 , vol. 53, # 12 p. 2809 - 2819 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 5 | |
CAS#:74377-94-9![1,4-dichloro-5H-pyridazino[4,5-b]indole structure](https://image.chemsrc.com/caspic/387/80985-56-4.png)
CAS#:80985-56-4![4-(1-morpholin-4-yl-5H-pyridazino[4,5-b]indol-4-yl)morpholine structure](https://image.chemsrc.com/caspic/349/80985-57-5.png)
CAS#:80985-57-5
CAS#:80985-63-3
CAS#:80985-65-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3-Dihydro-1H-pyridazino(4,5-b)indole-1,4(5H)-dione |
| 1,2,3,4-tetrahydro-5H-pyridazino<4,5-b>indole-1,4-dione |
| 1H-Pyridazino(4,5-b)indole-1,4(5H)-dione,2,3-dihydro |
| 2,3-dihydro-5H-pyridazino[4,5-b]indole-1,4-dione |
| 2,3-Dihydro-5H-pyridazino[4,5-b]indol-1,4-dion |
| 1,4-dioxo-1,2,3,4-tetrahydro-5H-pyridazino<4,5-b>indole |
| 1,2,3,4-tetrahydro-5H-pyridazino<4,5-b>indole |
| 1,2,3,4-tetrahydro-5H-pyridazino[4,5-b]indole-1,4(2H,3H)-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: Molecular formula of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione is C10H7N3O2. |
| Q: What is the SMILES notation of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: SMILES notation of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione is O=c1[nH][nH]c(=O)c2c1[nH]c1ccccc12. |
| Q: What is the molecular weight of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: Molecular weight of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione is 201.18100. |
| Q: What are the downstream products of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: Related downstream products(CAS) of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione: 74377-94-9;80985-56-4;80985-57-5;80985-63-3;80985-65-5. |
| Q: What is the InChIKey of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: InChIKey of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione is PPGNWVBGMDBNHD-UHFFFAOYSA-N. |
| Q: What English synonyms does 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione have? |
| A: English synonyms of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione: 2,3-Dihydro-1H-pyridazino(4,5-b)indole-1,4(5H)-dione, 1,2,3,4-tetrahydro-5H-pyridazinoindole-1,4-dione, 1H-Pyridazino(4,5-b)indole-1,4(5H)-dione,2,3-dihydro, 2,3-dihydro-5H-pyridazino[4,5-b]indole-1,4-dione, 2,3-Dihydro-5H-pyridazino[4,5-b]indol-1,4-dion, 1,4-dioxo-1,2,3,4-tetrahydro-5H-pyridazinoindole, 1,2,3,4-tetrahydro-5H-pyridazinoindole, 1,2,3,4-tetrahydro-5H-pyridazino[4,5-b]indole-1,4(2H,3H)-dione. |
| Q: What is the CAS number of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: CAS number of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione is 80985-55-3. |
| Q: What is the LogP of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: LogP of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione is 1.52230. |
| Q: What is the Chinese name of 80985-55-3? |
| A: Chinese name of 80985-55-3 is 80985-55-3. |
| Q: What is the English name of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione? |
| A: The English name of 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione is 3,5-dihydro-2H-pyridazino[4,5-b]indole-1,4-dione. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |