Methyl 4-methyl-4-nitroso-2-trimethylsiloxy-pentanoate structure
|
Common Name | Methyl 4-methyl-4-nitroso-2-trimethylsiloxy-pentanoate | ||
|---|---|---|---|---|
| CAS Number | 80998-48-7 | Molecular Weight | 247.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21NO4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-methyl-4-nitroso-2-trimethylsilyloxypentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H21NO4Si |
|---|---|
| Molecular Weight | 247.36400 |
| Exact Mass | 247.12400 |
| PSA | 64.96000 |
| LogP | 2.31460 |
| InChIKey | BSZOQCQSNLQJBV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC(C)(C)N=O)O[Si](C)(C)C |
|
~0%
Methyl 4-methyl... CAS#:80998-48-7
Detail
|
| Literature: Mukerji, Somir K.; Torssell, Kurt B. G. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1981 , vol. 35, # 9 p. 643 - 648 |
|
~62%
Methyl 4-methyl... CAS#:80998-48-7 |
| Literature: Mukerji, Somir K.; Torssell, Kurt B. G. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1981 , vol. 35, # 9 p. 643 - 648 |
| methyl 2-trimethylsilyloxy-4-nitroso-4-methylpentanoate |
| Methyl 4-methyl-4-nitroso-2-trimethylsiloxy-pentanoate |
| Pentanoic acid,4-methyl-4-nitroso-2-[(trimethylsilyl)oxy]-,methyl ester |
| METHYL 4-METHYL-4-NITROSO-2-TRIMETHYLSILYLOXY-PENTANOATE |