2-bromo-1,4-dihydroxyanthraquinone structure
|
Common Name | 2-bromo-1,4-dihydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 81-52-7 | Molecular Weight | 319.10700 | |
| Density | 1.854g/cm3 | Boiling Point | 484.4ºC at 760 mmHg | |
| Molecular Formula | C14H7BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7ºC | |
| Name | 2-bromo-1,4-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.854g/cm3 |
|---|---|
| Boiling Point | 484.4ºC at 760 mmHg |
| Molecular Formula | C14H7BrO4 |
| Molecular Weight | 319.10700 |
| Flash Point | 246.7ºC |
| Exact Mass | 317.95300 |
| PSA | 74.60000 |
| LogP | 2.63570 |
| Index of Refraction | 1.75 |
| InChIKey | BPUAQNKWCBCCAA-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(Br)cc(O)c21 |
|
~%
2-bromo-1,4-dih... CAS#:81-52-7 |
| Literature: Dimroth; Friedemann; Kaemmerer Chemische Berichte, 1920 , vol. 53, p. 486 |
|
~%
2-bromo-1,4-dih... CAS#:81-52-7 |
| Literature: Dimroth; Schultze; Heinze Chemische Berichte, 1921 , vol. 54, p. 3047 |
|
~%
2-bromo-1,4-dih... CAS#:81-52-7 |
| Literature: Bayer and Co. Patent: DE114199 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 6, p. 366 |
|
~%
2-bromo-1,4-dih... CAS#:81-52-7 |
| Literature: Tanaka Proceedings of the Imperial Academy (Tokyo), vol. 3, p. 346 Chem. Zentralbl., 1927 , vol. 98, # II p. 1955 |
|
~%
2-bromo-1,4-dih... CAS#:81-52-7 |
| Literature: Dimroth; Schultze; Heinze Chemische Berichte, 1921 , vol. 54, p. 3047 |
|
~%
2-bromo-1,4-dih... CAS#:81-52-7 |
| Literature: Dimroth; Schultze; Heinze Chemische Berichte, 1921 , vol. 54, p. 3047 |
|
~%
2-bromo-1,4-dih... CAS#:81-52-7 |
| Literature: Eckert; Hampel Chemische Berichte, 1927 , vol. 60, p. 1700 |
|
~%
Detail
|
| Literature: Tanaka Proceedings of the Imperial Academy (Tokyo), vol. 3, p. 346 Chem. Zentralbl., 1927 , vol. 98, # II p. 1955 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| 2-Bromo-1,4-dihydroxyanthraquinone |
| 2-Brom-1,4-dihydroxy-anthrachinon |
| 2-bromoquinizarine |
| 1,4-dihydroxy-2-bromoanthraquinone |
| 2-bromoquinizarin |
| EINECS 201-357-7 |
| 2-Bromo-1,4-dihydroxy-9,10-anthraquinone |
| 9,10-Anthracenedione,2-bromo-1,4-dihydroxy |
| Anthraquinone,2-bromo-1,4-dihydroxy-(6CI,8CI) |
| 1,4-dihydroxy-2-bromo-9,10-anthraquinone |