4,16a-Dibromoestrone structure
|
Common Name | 4,16a-Dibromoestrone | ||
|---|---|---|---|---|
| CAS Number | 81072-41-5 | Molecular Weight | 428.15800 | |
| Density | 1.63g/cm3 | Boiling Point | 489.433ºC at 760 mmHg | |
| Molecular Formula | C18H20Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.801ºC | |
| Name | 4,16α-Dibromo Estrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 489.433ºC at 760 mmHg |
| Molecular Formula | C18H20Br2O2 |
| Molecular Weight | 428.15800 |
| Flash Point | 249.801ºC |
| Exact Mass | 425.98300 |
| PSA | 37.30000 |
| LogP | 4.95330 |
| Index of Refraction | 1.63 |
| InChIKey | WALNGSHUZXVAOU-BUSPIDHKSA-N |
| SMILES | CC12CCC3c4ccc(O)c(Br)c4CCC3C1CC(Br)C2=O |
|
~13%
4,16a-Dibromoestrone CAS#:81072-41-5
Detail
|
| Literature: Numazawa, Mitsuteru; Nagaoka, Masao; Tsuji, Masachika; Osawa, Yoshio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 1 p. 121 - 125 |
|
~%
4,16a-Dibromoestrone CAS#:81072-41-5
Detail
|
| Literature: Numazawa, Mitsuteru; Nagaoka, Masao; Tsuji, Masachika; Osawa, Yoshio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 1 p. 121 - 125 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,16a-Dibromo-3-hydroxyestra-1,3,5(10)-trien-17-one |
| (16a)-4,16-Dibromo-3-hydroxyestra-1,3,5(10)-trien-17-one |
| 4,16a-Dibromoestrone |