5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione
![5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione Structure](https://image.chemsrc.com/caspic/348/81077-48-7.png)
5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione structure
|
Common Name | 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 81077-48-7 | Molecular Weight | 341.27500 | |
| Density | 1.5g/cm3 | Boiling Point | 500.8ºC at 760 mmHg | |
| Molecular Formula | C16H11N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 500.8ºC at 760 mmHg |
| Molecular Formula | C16H11N3O6 |
| Molecular Weight | 341.27500 |
| Flash Point | 256.7ºC |
| Exact Mass | 341.06500 |
| PSA | 122.81000 |
| LogP | 2.75770 |
| Index of Refraction | 1.671 |
| InChIKey | WDVLQBZWFHMTMX-UHFFFAOYSA-N |
| SMILES | O=C1OC(c2ccccc2)OC(=O)C1=NNc1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-[(4-nitrophen... CAS#:81077-48-7 |
| Literature: Chaimow Trudy Tadziksk. selskochoz. Inst.Chem.Abstr., 1958 , vol. 1, p. 33,37 Trudy Tadziksk. selskochoz. Inst.Chem.Abstr., 1960 , p. 20975 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-phenyl-[1,3]dioxane-4,5,6-trione-5-(4-nitro-phenylhydrazone) |
| 2-Phenyl-[1,3]dioxan-4,5,6-trion-5-(4-nitro-phenylhydrazon) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: InChIKey of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione is WDVLQBZWFHMTMX-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: Related upstream materials(CAS) of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione: 3709-16-8. |
| Q: What is the molecular weight of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: Molecular weight of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione is 341.27500. |
| Q: What is the Chinese name of 81077-48-7? |
| A: Chinese name of 81077-48-7 is 81077-48-7. |
| Q: What English synonyms does 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione have? |
| A: English synonyms of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione: 2-phenyl-[1,3]dioxane-4,5,6-trione-5-(4-nitro-phenylhydrazone), 2-Phenyl-[1,3]dioxan-4,5,6-trion-5-(4-nitro-phenylhydrazon). |
| Q: What is the CAS number of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: CAS number of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione is 81077-48-7. |
| Q: What is the polar surface area (PSA) of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: Polar surface area (PSA) of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione is 122.81000. |
| Q: What is the English name of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: The English name of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione is 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione. |
| Q: What is the boiling point of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: Boiling point of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione is 500.8ºC at 760 mmHg. |
| Q: What is the SMILES notation of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione? |
| A: SMILES notation of 5-[(4-nitrophenyl)hydrazinylidene]-2-phenyl-1,3-dioxane-4,6-dione is O=C1OC(c2ccccc2)OC(=O)C1=NNc1ccc([N+](=O)[O-])cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |