Kaur-16-en-15-one,7,20-epoxy-1,6,7-trihydroxy-14-[(1-oxodecyl)oxy]-, (1a,6b,7a,14R)- (9CI) structure
|
Common Name | Kaur-16-en-15-one,7,20-epoxy-1,6,7-trihydroxy-14-[(1-oxodecyl)oxy]-, (1a,6b,7a,14R)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 81078-05-9 | Molecular Weight | 518.68200 | |
| Density | 1.22g/cm3 | Boiling Point | 650.8ºC at 760mmHg | |
| Molecular Formula | C30H46O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | 14-O-decanoyl oridonin |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 650.8ºC at 760mmHg |
| Molecular Formula | C30H46O7 |
| Molecular Weight | 518.68200 |
| Flash Point | 206.1ºC |
| Exact Mass | 518.32400 |
| PSA | 113.29000 |
| LogP | 4.06720 |
| Index of Refraction | 1.568 |
| InChIKey | KWUAMZOEZSIYNK-UHFFFAOYSA-N |
| SMILES | C=C1C(=O)C23C(OC(=O)CCCCCCCCC)C1CCC2C12COC3(O)C(O)C1C(C)(C)CCC2O |
|
~67%
Kaur-16-en-15-o... CAS#:81078-05-9 |
| Literature: Fujita; Nagao; Kohno; Matsuda; Ozaki Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 11 p. 3208 - 3213 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |