8-Chloro-1-phenyl-3H-2-benzazepine 2-oxide structure
|
Common Name | 8-Chloro-1-phenyl-3H-2-benzazepine 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 81078-23-1 | Molecular Weight | 269.72600 | |
| Density | 1.28g/cm3 | Boiling Point | 446.8ºC at 760 mmHg | |
| Molecular Formula | C16H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224ºC | |
| Name | 8-chloro-2-oxido-1-phenyl-3H-2-benzazepin-2-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760 mmHg |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.72600 |
| Flash Point | 224ºC |
| Exact Mass | 269.06100 |
| PSA | 28.75000 |
| LogP | 3.67330 |
| Index of Refraction | 1.669 |
| InChIKey | MMAZIPBCTHYOBH-UHFFFAOYSA-N |
| SMILES | [O-][N+]1=C(c2ccccc2)c2cc(Cl)ccc2C=CC1 |
|
~92%
8-Chloro-1-phen... CAS#:81078-23-1 |
| Literature: Trybulski, E.J.; Fryer, R.I.; Reeder, E.; Vitone, S.; Todaro, L. Journal of Organic Chemistry, 1986 , vol. 51, # 12 p. 2191 - 2202 |
|
~%
8-Chloro-1-phen... CAS#:81078-23-1 |
| Literature: Hoffmann-La Roche Inc. Patent: US4549988 A1, 1985 ; |
| 3H-2-Benzazepine,8-chloro-1-phenyl-,2-oxide |
| 8-Chlor-1-phenyl-3H-2-benzazepin-2-oxid |
| 8-chloro-1-phenyl-3H-2-benzazepine-2-oxide |
| 8-Chlor-1-phenyl-3H-2-benzazepin-2-oxid [German] |