N-(2-(Diethylamino)ethyl)-9,10-dihydro-9,10-dioxo-2-anthracenecarboxamide monohydrochloride structure
|
Common Name | N-(2-(Diethylamino)ethyl)-9,10-dihydro-9,10-dioxo-2-anthracenecarboxamide monohydrochloride | ||
|---|---|---|---|---|
| CAS Number | 81086-02-4 | Molecular Weight | 386.87200 | |
| Density | 1.211g/cm3 | Boiling Point | 539ºC at 760 mmHg | |
| Molecular Formula | C21H23ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.8ºC | |
| Name | N-[2-(diethylamino)ethyl]-9,10-dioxoanthracene-2-carboxamide,hydrochloride |
|---|
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 539ºC at 760 mmHg |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.87200 |
| Flash Point | 279.8ºC |
| Exact Mass | 386.14000 |
| PSA | 66.48000 |
| LogP | 3.72650 |
| Index of Refraction | 1.601 |
| InChIKey | YLXMWPUQEQZOCB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O.Cl |
|
~75%
N-(2-(Diethylam... CAS#:81086-02-4 |
| Literature: Breslin; Schuster Journal of the American Chemical Society, 1996 , vol. 118, # 10 p. 2311 - 2319 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |