6-Tosyl-6-azabicyclo[3.1.0]hexane structure
|
Common Name | 6-Tosyl-6-azabicyclo[3.1.0]hexane | ||
|---|---|---|---|---|
| CAS Number | 81097-48-5 | Molecular Weight | 237.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO2S |
|---|---|
| Molecular Weight | 237.31800 |
| Exact Mass | 237.08200 |
| PSA | 45.53000 |
| LogP | 2.93910 |
| InChIKey | KCGSYHXXVLNFJN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2C3CCCC32)cc1 |
| Storage condition | 2-8°C |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
|
Name: Inhibition of human recombinant GST-tagged AKR1C1 expressed in Escherichia coli BL21 ...
Source: ChEMBL
Target: Aldo-keto reductase family 1 member C1
External Id: CHEMBL1033524
|
|
Name: Inhibition of human recombinant GST-tagged AKR1C3 expressed in Escherichia coli BL21 ...
Source: ChEMBL
Target: Aldo-keto reductase family 1 member C3
External Id: CHEMBL1033525
|
| 6-tosyl-6-azacicyclo[3.1.0]hexane |
| N-Tosylcyclopentanoaziridine |
| 6-[(4-methylphenyl)sulfonyl]-6-azabicyclo[3.1.0]hexane |
| 6-Azabicyclo[3.1.0]hexane,6-[(4-methylphenyl)sulfonyl] |
| 1,2-[N-(p-toluenesulfonyl)imino]cyclopentane |
| N-tosyl-6-azabicyclo<3.1.0>hexane |
| 6-(4-methylbenzenesulfonyl)-6-azabicyclo[3.1.0]hexane |