2-Methoxy-5-nitrobenzene-1-sulfonyl chloride
Modify Date: 2025-08-26 15:38:13
2-Methoxy-5-nitrobenzene-1-sulfonyl chloride structure
|
Common Name | 2-Methoxy-5-nitrobenzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 81118-92-5 | Molecular Weight | 251.64400 | |
| Density | 1.554g/cm3 | Boiling Point | 407.232ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO5S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 200.087ºC | |
| Name | 2-methoxy-5-nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 407.232ºC at 760 mmHg |
| Molecular Formula | C7H6ClNO5S |
| Molecular Weight | 251.64400 |
| Flash Point | 200.087ºC |
| Exact Mass | 250.96600 |
| PSA | 97.57000 |
| LogP | 3.13490 |
| Index of Refraction | 1.566 |
| InChIKey | DSSUHBJSDMHACJ-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)Cl |
| HS Code | 2909309090 |
|---|
|
~%
2-Methoxy-5-nit... CAS#:81118-92-5 |
| Literature: TRANSTECH PHARMA, INC. Patent: WO2006/47302 A1, 2006 ; Location in patent: Page/Page column 52-53 ; WO 2006/047302 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![1-butyl-3-[4-[2-[(2-methoxy-5-nitrophenyl)sulfonylamino]ethyl]phenyl]sulfonylurea structure](https://image.chemsrc.com/caspic/066/81514-29-6.png)
CAS#:81514-29-6| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(methyloxy)-5-nitrobenzenesulfonyl chloride |
| 2-methoxy-5-nitro-benzenesulfonyl chloride |
| 2-methoxy-5-nitro-benzenesulphonyl chloride |
| 2-Methoxy-5-nitro-benzolsulfonylchlorid |