4-(Bromomethyl)-2,6-di-tert-butylpyridine structure
|
Common Name | 4-(Bromomethyl)-2,6-di-tert-butylpyridine | ||
|---|---|---|---|---|
| CAS Number | 81142-32-7 | Molecular Weight | 284.23500 | |
| Density | 1.157 g/cm3 | Boiling Point | 281.8ºC at 760 mmHg | |
| Molecular Formula | C14H22BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.2°C | |
| Name | 4-(bromomethyl)-2,6-ditert-butylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157 g/cm3 |
|---|---|
| Boiling Point | 281.8ºC at 760 mmHg |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.23500 |
| Flash Point | 124.2°C |
| Exact Mass | 283.09400 |
| PSA | 12.89000 |
| LogP | 4.57150 |
| Index of Refraction | 1.512 |
| InChIKey | KRGQGAXLBUQGQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CBr)cc(C(C)(C)C)n1 |
| HS Code | 2933399090 |
|---|
|
~94%
4-(Bromomethyl)... CAS#:81142-32-7 |
| Literature: Mobinikhaledi; Foroughifar Phosphorus, Sulfur and Silicon and the Related Elements, 2006 , vol. 181, # 2 p. 405 - 412 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2,6-di-tert-butyl-4-pyridyl)methylene bromide |
| 4-(Bromomethyl)-2,6-di(tert-butyl)pyridine |