MTSSL structure
|
Common Name | MTSSL | ||
|---|---|---|---|---|
| CAS Number | 81213-52-7 | Molecular Weight | 264.385 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18NO3S2 | Melting Point | 107-108ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of MTSSLMTSSL is a paramagnetic nitroxide spin label featuring a methanethiosulfonate group for site-directed spin labeling, particularly through disulfide linkages with cysteine residues on proteins |
| Name | 1-λ1-oxidanyl-2,2,5,5-tetramethyl-3-(methylsulfonylsulfanylmethyl)pyrrole |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 107-108ºC |
|---|---|
| Molecular Formula | C10H18NO3S2 |
| Molecular Weight | 264.385 |
| Exact Mass | 264.072815 |
| PSA | 71.06000 |
| LogP | 2.84260 |
| InChIKey | BLSCGBLQCTWVPO-UHFFFAOYSA-N |
| SMILES | CC1(C)C=C(CSS(C)(=O)=O)C(C)(C)N1[O] |
| MTSL |
| Otpm-mts |
| Mts-SL |
| Otmpmms |
| 1H-Pyrrol-1-yloxy, 2,5-dihydro-2,2,5,5-tetramethyl-3-[[(methylsulfonyl)thio]methyl]- |
| (2,2,5,5-Tetramethyl-3-{[(methylsulfonyl)sulfanyl]methyl}-2,5-dihydro-1H-pyrrol-1-yl)oxidanyl |
| Pmmts label |