(3,5-dimethylthieno[2,3-c]diazepin-1-yl)-phenylmethanone structure
|
Common Name | (3,5-dimethylthieno[2,3-c]diazepin-1-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 81224-01-3 | Molecular Weight | 282.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,5-dimethylthieno[2,3-c]diazepin-1-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N2OS |
|---|---|
| Molecular Weight | 282.36000 |
| Exact Mass | 282.08300 |
| PSA | 60.91000 |
| LogP | 3.68830 |
| InChIKey | VQFOAHZAKKHZIV-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)=NN(C(=O)c2ccccc2)c2sccc21 |
|
~12%
(3,5-dimethylth... CAS#:81224-01-3 |
| Literature: Kurita; Enkaku; Tsuchiya Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3684 - 3690 |
|
~10%
(3,5-dimethylth... CAS#:81224-01-3 |
| Literature: Tsuchiya; Enkaku; Okajima Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 11 p. 3173 - 3180 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1H-Thieno[2,3-c]-1,2-diazepine,1-benzoyl-3,5-dimethyl |