3-(2,6-dichlorophenyl)-1-phenyl-prop-2-en-1-one structure
|
Common Name | 3-(2,6-dichlorophenyl)-1-phenyl-prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 81226-97-3 | Molecular Weight | 277.14500 | |
| Density | 1.296g/cm3 | Boiling Point | 408.8ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | (E)-3-(2,6-dichlorophenyl)-1-phenylprop-2-en-1-one |
|---|
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 408.8ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2O |
| Molecular Weight | 277.14500 |
| Flash Point | 172.7ºC |
| Exact Mass | 276.01100 |
| PSA | 17.07000 |
| LogP | 4.88950 |
| Index of Refraction | 1.638 |
| InChIKey | DBXDWKVTMRWZDM-MDZDMXLPSA-N |
| SMILES | O=C(C=Cc1c(Cl)cccc1Cl)c1ccccc1 |
|
~51%
3-(2,6-dichloro... CAS#:81226-97-3 |
| Literature: Boumendjel, Ahcene; Boccard, Julien; Carrupt, Pierre-Alain; Nicolle, Edwige; Blanc, Madeleine; Geze, Annabelle; Choisnard, Luc; Wouessidjewe, Denis; Matera, Eva-Laure; Dumontet, Charles Journal of Medicinal Chemistry, 2008 , vol. 51, # 7 p. 2307 - 2310 |
|
~%
3-(2,6-dichloro... CAS#:81226-97-3 |
| Literature: Liu, Yun-Kui; Zhang, Yong-Min; Li, Zhi-Fang Journal of the Indian Chemical Society, 2002 , vol. 79, # 5 p. 433 - 436 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |