Methyl 4-(1-methyl-2-phenyl-3-indolizinyl)phenyl ether structure
|
Common Name | Methyl 4-(1-methyl-2-phenyl-3-indolizinyl)phenyl ether | ||
|---|---|---|---|---|
| CAS Number | 81235-52-1 | Molecular Weight | 313.39200 | |
| Density | 1.08g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methoxyphenyl)-1-methyl-2-phenylindolizine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.39200 |
| Exact Mass | 313.14700 |
| PSA | 13.64000 |
| LogP | 5.59030 |
| Index of Refraction | 1.6 |
| InChIKey | SWYZMSOBTNLJSA-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2c(-c3ccccc3)c(C)c3ccccn23)cc1 |
|
~%
Methyl 4-(1-met... CAS#:81235-52-1 |
| Literature: Berti, Corrado; Greci, Lucedio; Marchetti, Leonardo; Andruzzi, Romano; Trazza, Antonio Journal of Chemical Research, Miniprint, 1981 , # 11 p. 3944 - 3965 |
|
~20%
Methyl 4-(1-met... CAS#:81235-52-1 |
| Literature: Colonna, Martino; Greci, Lucedio; Poloni, Marino Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 2 p. 165 - 170 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-benzyl-1,2-dihydro-1-methyl-2-phenyl-3H-indol-3-one |