5'-DMT-rU structure
|
Common Name | 5'-DMT-rU | ||
|---|---|---|---|---|
| CAS Number | 81246-79-9 | Molecular Weight | 546.56800 | |
| Density | 1.343±0.06 g/cm3(Predicted) | Boiling Point | N/A | |
| Molecular Formula | C30H30N2O8 | Melting Point | 111-112 °C(Solv: ethyl acetate (141-78-6)) | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-DMT-rU5'-O-DMT-rU is a modified nucleoside and can be used to synthesize RNA. |
| Name | 5'-O-(4,4'-Dimethoxytrityl)uridine |
|---|---|
| Synonym | More Synonyms |
| Description | 5'-O-DMT-rU is a modified nucleoside and can be used to synthesize RNA. |
|---|---|
| Related Catalog |
| Density | 1.343±0.06 g/cm3(Predicted) |
|---|---|
| Melting Point | 111-112 °C(Solv: ethyl acetate (141-78-6)) |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.56800 |
| Exact Mass | 546.20000 |
| PSA | 132.24000 |
| LogP | 2.18170 |
| InChIKey | PCFSNQYXXACUHM-YULOIDQLSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Storage condition | 2-8℃ |
|
~98%
5'-DMT-rU CAS#:81246-79-9 |
| Literature: Journal of the American Chemical Society, , vol. 132, # 21 p. 7231 - 7233 |
|
~%
5'-DMT-rU CAS#:81246-79-9 |
| Literature: EP2006293 A2, ; Page/Page column 17 ; |
|
~%
5'-DMT-rU CAS#:81246-79-9 |
| Literature: EP2479182 A1, ; Page/Page column 21-22 ; |
|
~%
5'-DMT-rU CAS#:81246-79-9 |
| Literature: EP2479182 A1, ; |
|
~%
5'-DMT-rU CAS#:81246-79-9 |
| Literature: EP2479182 A1, ; |
|
~%
5'-DMT-rU CAS#:81246-79-9 |
| Literature: EP2479182 A1, ; |
| 5'-DMTr-uridine |
| 5'-O-DMT-uridine |
| 5'-O-DMTr-uridine |
| DMT-RIBOURIDINE |
| 5'-DMT-rU |