6-Amino-1,3-dipropyl-5-nitrosouracil structure
|
Common Name | 6-Amino-1,3-dipropyl-5-nitrosouracil | ||
|---|---|---|---|---|
| CAS Number | 81250-33-1 | Molecular Weight | 240.25900 | |
| Density | 1.34 g/cm3 | Boiling Point | 309.4ºC at 760 mmHg | |
| Molecular Formula | C10H16N4O3 | Melting Point | 205-210ºC | |
| MSDS | N/A | Flash Point | 140.9ºC | |
| Name | 6-amino-5-nitroso-1,3-dipropylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34 g/cm3 |
|---|---|
| Boiling Point | 309.4ºC at 760 mmHg |
| Melting Point | 205-210ºC |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.25900 |
| Flash Point | 140.9ºC |
| Exact Mass | 240.12200 |
| PSA | 99.45000 |
| LogP | 1.39130 |
| InChIKey | HLHWJHPBAYITQE-UHFFFAOYSA-N |
| SMILES | CCCn1c(N)c(N=O)c(=O)n(CCC)c1=O |
| Storage condition | Refrigerator |
| Stability | Stable at RT |
| HS Code | 2933599090 |
|---|
|
~98%
6-Amino-1,3-dip... CAS#:81250-33-1 |
| Literature: Soriano, Aroa; Ventura, Ruben; Molero, Anabel; Hoen, Rob; Casado, Vicent; Corte, Antoni; Fanelli, Francesca; Albericio, Fernando; Lluis, Carmen; Franco, Rafael; Royo, Miriam Journal of Medicinal Chemistry, 2009 , vol. 52, # 18 p. 5590 - 5602 |
|
~%
6-Amino-1,3-dip... CAS#:81250-33-1 |
| Literature: Farmaco, , vol. 60, # 8 p. 643 - 651 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dipropyl-5-nitroso-6-amino-uracil |
| ZLD0208 |
| 6-Amino-5-nitroso-1,3-dipropyl-1H-pyrimidin-2,4-dion |
| 1,3-di-n-propyl-5-nitroso-6-aminouracil |
| 6-amino-5-nitroso-1,3-dipropyl-1H-pyrimidine-2,4-dione |
| 6-Amino-1,3-dipropyl-5-nitroso uracil |
| 1,3-dipropyl-6-amino-5-nitrosouracil |