3-(carboxymethylsulfanyl)-2-[(2,4-dinitrophenyl)amino]propanoic acid structure
|
Common Name | 3-(carboxymethylsulfanyl)-2-[(2,4-dinitrophenyl)amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 81251-80-1 | Molecular Weight | 345.28500 | |
| Density | 1.707g/cm3 | Boiling Point | 677.6ºC at 760 mmHg | |
| Molecular Formula | C11H11N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.6ºC | |
| Name | 3-(carboxymethylsulfanyl)-2-(2,4-dinitroanilino)propanoic acid |
|---|
| Density | 1.707g/cm3 |
|---|---|
| Boiling Point | 677.6ºC at 760 mmHg |
| Molecular Formula | C11H11N3O8S |
| Molecular Weight | 345.28500 |
| Flash Point | 363.6ºC |
| Exact Mass | 345.02700 |
| PSA | 203.57000 |
| LogP | 2.30530 |
| Index of Refraction | 1.704 |
| InChIKey | BJHCIIGBNBTLBY-UHFFFAOYSA-N |
| SMILES | O=C(O)CSCC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
|
~%
3-(carboxymethy... CAS#:81251-80-1 |
| Literature: Li; Cummins Journal of Biological Chemistry, 1958 , vol. 233, p. 73,74 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |