1,7,8,9-tetrahydropyrano[2,3-g]indole-2-carboxylic acid structure
|
Common Name | 1,7,8,9-tetrahydropyrano[2,3-g]indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 81257-90-1 | Molecular Weight | 217.22100 | |
| Density | 1.426g/cm3 | Boiling Point | 504.9ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.2ºC | |
| Name | 1,7,8,9-tetrahydropyrano[2,3-g]indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 504.9ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 259.2ºC |
| Exact Mass | 217.07400 |
| PSA | 62.32000 |
| LogP | 2.19110 |
| Index of Refraction | 1.705 |
| InChIKey | DJJRKYNKJQAPHU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2ccc3c(c2[nH]1)CCCO3 |
|
~82%
1,7,8,9-tetrahy... CAS#:81257-90-1 |
| Literature: Ta Kim; Guilard; Renaut Canadian Journal of Chemistry, 1982 , vol. 60, # 16 p. 2093 - 2098 |
|
~%
1,7,8,9-tetrahy... CAS#:81257-90-1 |
| Literature: Ta Kim; Guilard; Renaut Canadian Journal of Chemistry, 1982 , vol. 60, # 16 p. 2093 - 2098 |
|
~%
1,7,8,9-tetrahy... CAS#:81257-90-1 |
| Literature: Ta Kim; Guilard; Renaut Canadian Journal of Chemistry, 1982 , vol. 60, # 16 p. 2093 - 2098 |
| Pyrano(2,3-g)indole-2-carboxylic acid,1,7,8,9-tetrahydro |
| acide tetrahydro-1,7,8,9-pyranno<2,3-g>indolecarboxylique-2 |
| Acide 7,8,9-trihydro-pyranno(2,3-g)indole-2-carboxylique [French] |
| 7,8,9-trihydro-pyrano[2,3-g]indole-2-carboxylic acid |
| Acide 7,8,9-trihydro-pyranno(2,3-g)indole-2-carboxylique |
| 1,7,8,9-Tetrahydropyrano(2,3-g)indole-2-carboxylic acid |
| 7,8-dihydro-9H-pyrano[2,3-g]indole-2-carboxylic acid |