1-(3-BROMOBENZYL)-PIPERAZINE structure
|
Common Name | 1-(3-BROMOBENZYL)-PIPERAZINE | ||
|---|---|---|---|---|
| CAS Number | 812642-64-1 | Molecular Weight | 278.14400 | |
| Density | 1.36g/cm3 | Boiling Point | 393.2ºC at 760 mmHg | |
| Molecular Formula | C13H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | 1-(3-bromophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760 mmHg |
| Molecular Formula | C13H12BrNO |
| Molecular Weight | 278.14400 |
| Flash Point | 191.6ºC |
| Exact Mass | 277.01000 |
| PSA | 22.00000 |
| LogP | 3.66910 |
| Index of Refraction | 1.596 |
| InChIKey | LMMZIVDXKFJSTA-UHFFFAOYSA-N |
| SMILES | Cc1cc(C=O)c(C)n1-c1cccc(Br)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |