3-(p-(2H-Indazol-2-yl)phenyl)propionic acid structure
|
Common Name | 3-(p-(2H-Indazol-2-yl)phenyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 81265-72-7 | Molecular Weight | 266.29500 | |
| Density | 1.24g/cm3 | Boiling Point | 370.4ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.8ºC | |
| Name | 3-(4-indazol-2-ylphenyl)propanoic acid |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 370.4ºC at 760 mmHg |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29500 |
| Flash Point | 177.8ºC |
| Exact Mass | 266.10600 |
| PSA | 55.12000 |
| LogP | 3.04270 |
| Index of Refraction | 1.639 |
| InChIKey | KGHGHHMJJVKOTJ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(-n2cc3ccccc3n2)cc1 |
| HS Code | 2933990090 |
|---|
|
~77%
3-(p-(2H-Indazo... CAS#:81265-72-7 |
| Literature: Picciola; Ravenna; Carenini; Gentili; Riva Farmaco, Edizione Scientifica, 1981 , vol. 36, # 12 p. 1037 - 1056 |
|
~%
3-(p-(2H-Indazo... CAS#:81265-72-7 |
| Literature: Picciola; Ravenna; Carenini; Gentili; Riva Farmaco, Edizione Scientifica, 1981 , vol. 36, # 12 p. 1037 - 1056 |
|
~%
3-(p-(2H-Indazo... CAS#:81265-72-7 |
| Literature: Picciola; Ravenna; Carenini; Gentili; Riva Farmaco, Edizione Scientifica, 1981 , vol. 36, # 12 p. 1037 - 1056 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |