N-[4-[9-(4-acetamidophenyl)sulfanylfluoren-9-yl]sulfanylphenyl]acetamide structure
|
Common Name | N-[4-[9-(4-acetamidophenyl)sulfanylfluoren-9-yl]sulfanylphenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 81269-14-9 | Molecular Weight | 496.64300 | |
| Density | 1.35g/cm3 | Boiling Point | 795.7ºC at 760 mmHg | |
| Molecular Formula | C29H24N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 435ºC | |
| Name | N-[4-[9-(4-acetamidophenyl)sulfanylfluoren-9-yl]sulfanylphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 795.7ºC at 760 mmHg |
| Molecular Formula | C29H24N2O2S2 |
| Molecular Weight | 496.64300 |
| Flash Point | 435ºC |
| Exact Mass | 496.12800 |
| PSA | 108.80000 |
| LogP | 7.51550 |
| Index of Refraction | 1.725 |
| InChIKey | BAHHCHARDBOTTE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(SC2(Sc3ccc(NC(C)=O)cc3)c3ccccc3-c3ccccc32)cc1 |
|
~90%
N-[4-[9-(4-acet... CAS#:81269-14-9 |
| Literature: Morkved; Cronyn Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 1 p. 59 - 63 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9,9-bis(4-acetamidothiophenyl)fluorene |
| N-(4-[(9-([4-(Acetylamino)phenyl]sulfanyl)-9H-fluoren-9-yl)sulfanyl]phenyl)acetamide |
| 9,9-Bis[4-acetamidophenylthio]fluorene |