ethyl 9-methyl-3-oxo-2-oxa-8,9-diazabicyclo[4.3.0]nona-4,7,10-triene-7-carboxylate structure
|
Common Name | ethyl 9-methyl-3-oxo-2-oxa-8,9-diazabicyclo[4.3.0]nona-4,7,10-triene-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 81292-17-3 | Molecular Weight | 222.19700 | |
| Density | 1.4g/cm3 | Boiling Point | 430.9ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | ethyl 1-methyl-6-oxopyrano[2,3-c]pyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 430.9ºC at 760 mmHg |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.19700 |
| Flash Point | 214.4ºC |
| Exact Mass | 222.06400 |
| PSA | 74.33000 |
| LogP | 0.70320 |
| Index of Refraction | 1.608 |
| InChIKey | ZWZAESFGXCNLLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nn(C)c2oc(=O)ccc12 |
|
~24%
ethyl 9-methyl-... CAS#:81292-17-3 |
| Literature: Ueda; Mase; Oda; Ito Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 12 p. 3522 - 3528 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-ethoxycarbonyl-1-methylpyrano<2,3-c>pyrazol-6(1H)-one |