N,5-dimethyl-3-oxo-9-phenyl-2-oxa-8,9-diazabicyclo[4.3.0]nona-4,7,10-triene-7-carboxamide structure
|
Common Name | N,5-dimethyl-3-oxo-9-phenyl-2-oxa-8,9-diazabicyclo[4.3.0]nona-4,7,10-triene-7-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 81292-28-6 | Molecular Weight | 283.28200 | |
| Density | 1.36g/cm3 | Boiling Point | 499.6ºC at 760 mmHg | |
| Molecular Formula | C15H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.9ºC | |
| Name | N,4-dimethyl-6-oxo-1-phenylpyrano[2,3-c]pyrazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 499.6ºC at 760 mmHg |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.28200 |
| Flash Point | 255.9ºC |
| Exact Mass | 283.09600 |
| PSA | 77.13000 |
| LogP | 2.03760 |
| Index of Refraction | 1.659 |
| InChIKey | AUKYHPCTKWGULV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C(=NN2C3=CC=CC=C3)C(=O)NC |
|
~31%
N,5-dimethyl-3-... CAS#:81292-28-6 |
| Literature: Ueda; Mase; Oda; Ito Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 12 p. 3522 - 3528 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methyl-3-methylcarbamoyl-1-phenylpyrano[2,3-c]pyrazol-6(1H)-one |