methyl 4,4,5,5,6,6,6-heptafluorohex-2-enoate structure
|
Common Name | methyl 4,4,5,5,6,6,6-heptafluorohex-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 813-06-9 | Molecular Weight | 254.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4,4,5,5,6,6,6-heptafluorohex-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5F7O2 |
|---|---|
| Molecular Weight | 254.10200 |
| Exact Mass | 254.01800 |
| PSA | 26.30000 |
| LogP | 2.54850 |
| InChIKey | RZGXSYUEDNRGNQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C=CC(F)(F)C(F)(F)C(F)(F)F |
|
~93%
methyl 4,4,5,5,... CAS#:813-06-9 |
| Literature: Aoyagi, Katsuhiro; Haga, Toshihiko; Toi, Hiroo; Aoyama, Yasuhiro; Mizutani, Tadashi; Ogoshi, Hisanobu Bulletin of the Chemical Society of Japan, 1997 , vol. 70, # 4 p. 937 - 943 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| methyl 4,4,5,5,6,6,6-heptafluoro-2-hexenoate |
| Methyl-3-perfluorpropyl-acrylat |
| 2-Hexenoic acid,4,4,5,5,6,6,6-heptafluoro-,methyl ester |