1-nitrotriphenylene structure
|
Common Name | 1-nitrotriphenylene | ||
|---|---|---|---|---|
| CAS Number | 81316-78-1 | Molecular Weight | 273.28500 | |
| Density | 1.342g/cm3 | Boiling Point | 505ºC at 760 mmHg | |
| Molecular Formula | C18H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
| Name | 1-nitrotriphenylene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 505ºC at 760 mmHg |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.28500 |
| Flash Point | 252.5ºC |
| Exact Mass | 273.07900 |
| PSA | 45.82000 |
| LogP | 5.57760 |
| Index of Refraction | 1.791 |
| InChIKey | HCZVRRQDPKTLAK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c3ccccc3c3ccccc3c12 |
|
~9%
1-nitrotriphenylene CAS#:81316-78-1 |
| Literature: Ishii, Satoko; Hisamatsu, Yoshiharu; Inazu, Koji; Kadoi, Morio; Aika, Ken-Ichi Environmental Science and Technology, 2000 , vol. 34, # 10 p. 1893 - 1899 |
| 1-Nitro-triphenylen |
| 1-nitrophenylene |
| Triphenylene,1-nitro |
| 1-Nitro-triphenylene |