4-methyl-N-octan-2-ylbenzenesulfonamide structure
|
Common Name | 4-methyl-N-octan-2-ylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 81330-00-9 | Molecular Weight | 283.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-octan-2-ylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H25NO2S |
|---|---|
| Molecular Weight | 283.43000 |
| Exact Mass | 283.16100 |
| PSA | 54.55000 |
| LogP | 5.10390 |
| InChIKey | VZWWMPFZJUXWQS-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)NS(=O)(=O)c1ccc(C)cc1 |
|
~88%
4-methyl-N-octa... CAS#:81330-00-9 |
| Literature: Tsunoda, Tetsuto; Yamamoto, Hidetoshi; Goda, Kayo; Ito, Sho Tetrahedron Letters, 1996 , vol. 37, # 14 p. 2457 - 2458 |
|
~26%
4-methyl-N-octa... CAS#:81330-00-9 |
| Literature: Giner, Xavier; Najera, Carmen; Kovacs, Gabor; Lledos, Agusti; Ujaque, Gregori Advanced Synthesis and Catalysis, 2011 , vol. 353, # 18 p. 3451 - 3466 |
|
~%
4-methyl-N-octa... CAS#:81330-00-9 |
| Literature: Nickon,A.; Hill,A.S. Journal of the American Chemical Society, 1964 , vol. 86, p. 1152 - 1159 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| N-(1-methylheptyl)-p-toluenesulfonamide |
| Benzenesulfonamide,4-methyl-N-(1-methylheptyl) |
| 4-methyl-N-(octan-2-yl)benzenesulfonamide |
| N-<Octyl-(2)>-toluolsulfonamid |
| N-(2-octyl)-p-toluenesulfonamide |