3α,15-bis(chloroacetoxy)scirpen-4-one structure
|
Common Name | 3α,15-bis(chloroacetoxy)scirpen-4-one | ||
|---|---|---|---|---|
| CAS Number | 81331-27-3 | Molecular Weight | 433.28000 | |
| Density | 1.44g/cm3 | Boiling Point | 533.6ºC at 760 mmHg | |
| Molecular Formula | C19H22Cl2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192ºC | |
| Name | 3α,15-bis(chloroacetoxy)scirpen-4-one |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 533.6ºC at 760 mmHg |
| Molecular Formula | C19H22Cl2O7 |
| Molecular Weight | 433.28000 |
| Flash Point | 192ºC |
| Exact Mass | 432.07400 |
| PSA | 91.43000 |
| LogP | 1.77090 |
| Index of Refraction | 1.57 |
| InChIKey | VNCQNCMKHOIMRR-UHFFFAOYSA-N |
| SMILES | CC1=CC2OC3C(OC(=O)CCl)C(=O)C(C)(C2(COC(=O)CCl)CC1)C31CO1 |
|
~22%
3α,15-bis(chlor... CAS#:81331-27-3 |
| Literature: Kaneko; Schmitz; Essery; Rose; Howell; O'Herron; Nachfolger; Huftalen; Bradner; Partyka; Doyle; Davies; Cundliffe Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 579 - 589 |
|
~%
3α,15-bis(chlor... CAS#:81331-27-3 |
| Literature: Kaneko; Schmitz; Essery; Rose; Howell; O'Herron; Nachfolger; Huftalen; Bradner; Partyka; Doyle; Davies; Cundliffe Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 579 - 589 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |