4β-acetoxy-3α-hydroxyscirpene-15-carboxaldehyde semicarbazone structure
|
Common Name | 4β-acetoxy-3α-hydroxyscirpene-15-carboxaldehyde semicarbazone | ||
|---|---|---|---|---|
| CAS Number | 81331-36-4 | Molecular Weight | 379.40800 | |
| Density | 1.58g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4β-acetoxy-3α-hydroxyscirpene-15-carboxaldehyde semicarbazone |
|---|
| Density | 1.58g/cm3 |
|---|---|
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.40800 |
| Exact Mass | 379.17400 |
| PSA | 135.77000 |
| LogP | 1.30710 |
| Index of Refraction | 1.686 |
| InChIKey | FVADZRAFRRDSGY-IFRROFPPSA-N |
| SMILES | CC(=O)OC1C(O)C2OC3C=C(C)CCC3(C=NNC(N)=O)C1(C)C21CO1 |
|
~73%
4β-acetoxy-3α-h... CAS#:81331-36-4 |
| Literature: Kaneko; Schmitz; Essery; Rose; Howell; O'Herron; Nachfolger; Huftalen; Bradner; Partyka; Doyle; Davies; Cundliffe Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 579 - 589 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |