4-(6-methoxynaphthalen-1-yl)-4-oxo-butanoic acid structure
|
Common Name | 4-(6-methoxynaphthalen-1-yl)-4-oxo-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 81336-20-1 | Molecular Weight | 258.26900 | |
| Density | 1.249g/cm3 | Boiling Point | 490.4ºC at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | Propionic acid, 3-(6-methoxy-1-naphthoyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 490.4ºC at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 187.8ºC |
| Exact Mass | 258.08900 |
| PSA | 63.60000 |
| LogP | 2.89590 |
| Index of Refraction | 1.609 |
| InChIKey | UPNMFPDHXXSUBH-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(C(=O)CCC(=O)O)cccc2c1 |
|
~55%
4-(6-methoxynap... CAS#:81336-20-1 |
| Literature: Mejer, Stanislaw; Respondek, Stefania; Lusiak, Przemyslaw Polish Journal of Chemistry, 1984 , vol. 58, # 10-12 p. 1071 - 1075 |
|
~%
4-(6-methoxynap... CAS#:81336-20-1 |
| Literature: Dauben; Saegebarth Journal of the American Chemical Society, 1951 , vol. 73, p. 1853 |
|
~25%
4-(6-methoxynap... CAS#:81336-20-1 |
| Literature: Chatterjee, A.; Raychaudhuri, S. R.; Chatterjee, S. K. Tetrahedron, 1981 , vol. 37, # 21 p. 3653 - 3660 |
|
~%
4-(6-methoxynap... CAS#:81336-20-1 |
| Literature: Islam, Mojahidul; Siddiqui, Anees A.; Rajesh, Ramadoss Acta Poloniae Pharmaceutica - Drug Research, 2008 , vol. 65, # 3 p. 353 - 362 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-Nitrofuranacrylicacid |
| 5-nitro-2-furylacrylicacid |
| 5-nitrofuranyl propenoic acid |
| 4-(6-methoxy-[1]naphthyl)-4-oxo-butyric acid |
| 5-nitrofurylacrylicacid |
| 4-(6-Methoxy-[1]naphthyl)-4-oxo-buttersaeure |
| 5-nfa |
| 3-(5-nitrofuryl)propenoic acid |
| nitrofurylacrylamide |
| 3-(5-nitro-2-furyl)propenoic acid |
| RARECHEM BK HD 0012 |
| nitrofurylacrylicacid |
| 5-nitro-2-furanacrylicaci |
| 3-(5-nitrofuran-2-yl)propenoic acid |