5'-adenylic acid, monoanhydride with (dichlorophosphonomethyl)phosphonic acid structure
|
Common Name | 5'-adenylic acid, monoanhydride with (dichlorophosphonomethyl)phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 81336-74-5 | Molecular Weight | 542.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16Cl2N5O10P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5'-adenylic acid, monoanhydride with (dichlorophosphonomethyl)phosphonic acid |
|---|
| Molecular Formula | C11H16Cl2N5O10P3 |
|---|---|
| Molecular Weight | 542.10000 |
| Exact Mass | 540.94900 |
| PSA | 258.87000 |
| LogP | 1.55610 |
| InChIKey | MYVOXUCRWLLKSA-IOSLPCCCSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)CP(=O)(OCl)OCl)C(O)C1O |