tert-butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate structure
|
Common Name | tert-butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 813433-68-0 | Molecular Weight | 243.29900 | |
| Density | 1.084g/cm3 | Boiling Point | 304.797ºC at 760 mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.137ºC | |
| Name | tert-butyl 2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 304.797ºC at 760 mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.29900 |
| Flash Point | 138.137ºC |
| Exact Mass | 243.14700 |
| PSA | 55.84000 |
| LogP | 1.88690 |
| Index of Refraction | 1.469 |
| InChIKey | LZYBAKVGAMQFLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CCCN1C(=O)OC(C)(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Boc-pyrrolidin-2-yl-acetic acid methyl ester |