5-(chloromethyl)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecan-3-one structure
|
Common Name | 5-(chloromethyl)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecan-3-one | ||
|---|---|---|---|---|
| CAS Number | 81382-20-9 | Molecular Weight | 237.71300 | |
| Density | 1.34g/cm3 | Boiling Point | 232.9ºC at 760 mmHg | |
| Molecular Formula | C7H12ClNO4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.6ºC | |
| Name | 5-(chloromethyl)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 232.9ºC at 760 mmHg |
| Molecular Formula | C7H12ClNO4Si |
| Molecular Weight | 237.71300 |
| Flash Point | 94.6ºC |
| Exact Mass | 237.02200 |
| PSA | 48.00000 |
| Index of Refraction | 1.512 |
| InChIKey | YKVBLHUJBYGRLU-UHFFFAOYSA-N |
| SMILES | O=C1CN2CCO[Si](CCl)(OCC2)O1 |
|
~65%
5-(chloromethyl... CAS#:81382-20-9 |
| Literature: Kupce, E.; Liepins, E.; Lapsina, A.; Zelchan, G.; Lukevics, E. Journal of Organometallic Chemistry, 1983 , vol. 251, # 1 p. 15 - 30 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(chloromethyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-one |
| 2,8,9-Trioxa-5-aza-1-silabicyclo(3.3.3)undecan-3-one,1-chloromethyl |
| 1-chloromethylsilatran-3-one |